4,4-Stilbenedicarboxylic acid

• CAS: 100-31-2
• Catalog Number: ACM100312
• Category: Renewable & Alternative Energy
• Molecular Weight: 268.26
• Molecular Formula: C₁₆H₁₂O₄
• Synonyms: 4,4-STILBENEDICARBOXYLIC ACID;TIMTEC-BB SBB007944;TRANS-4,4-STILBENE-4,4-DICARBOXYLIC ACID;4,4-Stilbenedicaroxylic acid;4,4-stibenedicarboxylic acid;TRANS-4,4-STIBENE-4,4-DICARBOXYLIC ACID;4,4-Stilbenedicarboxylic acid, 95+%;4,4 SILBENE DICARBOXYLIC ACID

Custom Q&A

What is the molecular formula of 4,4-Stilbenedicarboxylic acid?

The molecular formula of 4,4-Stilbenedicarboxylic acid is C16H12O4.

What is the molecular weight of 4,4-Stilbenedicarboxylic acid?

The molecular weight of 4,4-Stilbenedicarboxylic acid is 268.26 g/mol.

What is the IUPAC name of 4,4-Stilbenedicarboxylic acid?

The IUPAC name of 4,4-Stilbenedicarboxylic acid is 4-[(E)-2-(4-carboxyphenyl)ethenyl]benzoic acid.

What is the InChI of 4,4-Stilbenedicarboxylic acid?

The InChI of 4,4-Stilbenedicarboxylic acid is InChI=1S/C16H12O4/c17-15(18)13-7-3-11(4-8-13)1-2-12-5-9-14(10-6-12)16(19)20/h1-10H,(H,17,18)(H,19,20)/b2-1+.

What is the InChIKey of 4,4-Stilbenedicarboxylic acid?

The InChIKey of 4,4-Stilbenedicarboxylic acid is SBBQDUFLZGOASY-OWOJBTEDSA-N.

What is the canonical SMILES of 4,4-Stilbenedicarboxylic acid?

The canonical SMILES of 4,4-Stilbenedicarboxylic acid is C1=CC(=CC=C1C=CC2=CC=C(C=C2)C(=O)O).

How many hydrogen bond donor counts does 4,4-Stilbenedicarboxylic acid have?

4,4-Stilbenedicarboxylic acid has 2 hydrogen bond donor counts.

How many hydrogen bond acceptor counts does 4,4-Stilbenedicarboxylic acid have?

4,4-Stilbenedicarboxylic acid has 4 hydrogen bond acceptor counts.

How many rotatable bond counts does 4,4-Stilbenedicarboxylic acid have?

4,4-Stilbenedicarboxylic acid has 4 rotatable bond counts.

What is the topological polar surface area of 4,4-Stilbenedicarboxylic acid?

The topological polar surface area of 4,4-Stilbenedicarboxylic acid is 74.6Ų.