--- Purity
---
If you have any other questions or need other size, please get a quote.
Specification
The molecular formula of the compound is C10H12FNO2.
The molecular weight of the compound is 197.21 g/mol.
The IUPAC name of the compound is 4-(4-fluorophenoxy)butanamide.
The InChI of the compound is InChI=1S/C10H12FNO2/c11-8-3-5-9(6-4-8)14-7-1-2-10(12)13/h3-6H,1-2,7H2,(H2,12,13).
The InChIKey of the compound is XTZDDXIQIAMJCO-UHFFFAOYSA-N.
The canonical SMILES of the compound is C1=CC(=CC=C1OCCCC(=O)N)F.
The XLogP3-AA value of the compound is 1.2.
The compound has 1 hydrogen bond donor count.
The compound has 3 hydrogen bond acceptor counts.
The compound has 5 rotatable bond counts.