4-(2-Phenylethoxy)benzaldehyde

• Catalog Number: ACMA00002522
• Category: Ethers
• Molecular Weight: 226.27
• Molecular Formula: C₁₅H₁₃ClO₃
• Hazard Statements: H302-H319
• RIDADR: UN 2811 6.1 / PGIII
• Symbol: GHS07

Custom Q&A

What is the molecular formula of 4-(2-phenylethoxy)benzaldehyde?

The molecular formula of 4-(2-phenylethoxy)benzaldehyde is C15H14O2.

What is the molecular weight of 4-(2-phenylethoxy)benzaldehyde?

The molecular weight of 4-(2-phenylethoxy)benzaldehyde is 226.27 g/mol.

What is the IUPAC name of 4-(2-phenylethoxy)benzaldehyde?

The IUPAC name of 4-(2-phenylethoxy)benzaldehyde is 4-(2-phenylethoxy)benzaldehyde.

What is the InChI of 4-(2-phenylethoxy)benzaldehyde?

The InChI of 4-(2-phenylethoxy)benzaldehyde is InChI=1S/C15H14O2/c16-12-14-6-8-15(9-7-14)17-11-10-13-4-2-1-3-5-13/h1-9,12H,10-11H2.

What is the InChIKey of 4-(2-phenylethoxy)benzaldehyde?

The InChIKey of 4-(2-phenylethoxy)benzaldehyde is NWWORWIYBLAYJD-UHFFFAOYSA-N.

What is the canonical SMILES of 4-(2-phenylethoxy)benzaldehyde?

The canonical SMILES of 4-(2-phenylethoxy)benzaldehyde is C1=CC=C(C=C1)CCOC2=CC=C(C=C2)C=O.

What is the XLogP3-AA value of 4-(2-phenylethoxy)benzaldehyde?

The XLogP3-AA value of 4-(2-phenylethoxy)benzaldehyde is 3.3.

How many hydrogen bond donor counts are there in 4-(2-phenylethoxy)benzaldehyde?

There are 0 hydrogen bond donor counts in 4-(2-phenylethoxy)benzaldehyde.

How many hydrogen bond acceptor counts are there in 4-(2-phenylethoxy)benzaldehyde?

There are 2 hydrogen bond acceptor counts in 4-(2-phenylethoxy)benzaldehyde.

How many rotatable bond counts are there in 4-(2-phenylethoxy)benzaldehyde?

There are 5 rotatable bond counts in 4-(2-phenylethoxy)benzaldehyde.