4-(2-Hydroxy-3-isopropylaminopropoxy)phenylacetic acid

• CAS: 56392-14-4
• Catalog Number: ACM56392144
• Category: Ethers
• Molecular Weight: 267.32
• Molecular Formula: C₁₄H₁₉NO₄
• Hazard Statements: H302
• RIDADR: NONH for all modes of transport
• Symbol: GHS07

Custom Q&A

What is the molecular formula of the compound?

The molecular formula is C14H21NO4.

What is the molecular weight of the compound?

The molecular weight is 267.32 g/mol.

What is the IUPAC name of the compound?

The IUPAC name is 2-[4-[2-hydroxy-3-(propan-2-ylamino)propoxy]phenyl]acetic acid.

What is the InChIKey of the compound?

The InChIKey is PUQIRTNPJRFRCZ-UHFFFAOYSA-N.

What is the canonical SMILES of the compound?

The canonical SMILES is CC(C)NCC(COC1=CC=C(C=C1)CC(=O)O).

What is the CAS number of the compound?

The CAS number is 56392-14-4.

What is the XLogP3 value of the compound?

The XLogP3 value is -1.5.

How many hydrogen bond donor count does the compound have?

The compound has 3 hydrogen bond donor count.

How many hydrogen bond acceptor count does the compound have?

The compound has 5 hydrogen bond acceptor count.

How many rotatable bond count does the compound have?

The compound has 8 rotatable bond count.