4-(2-Amino-2-oxoethoxy)benzoic acid

• Catalog Number: ACMA00002916
• Category: Ethers
• Molecular Weight: 195.17
• Molecular Formula: C₉H₉ClO₃
• Hazard Statements: H302-H318
• RIDADR: NONH for all modes of transport
• Symbol: GHS05

Custom Q&A

What is the molecular formula of 4-(2-amino-2-oxoethoxy)benzoic acid?

The molecular formula is C9H9NO4.

What is the molecular weight of 4-(2-amino-2-oxoethoxy)benzoic acid?

The molecular weight is 195.17 g/mol.

What is the IUPAC name of 4-(2-amino-2-oxoethoxy)benzoic acid?

The IUPAC name is 4-(2-amino-2-oxoethoxy)benzoic acid.

What is the InChI of 4-(2-amino-2-oxoethoxy)benzoic acid?

The InChI is InChI=1S/C9H9NO4/c10-8(11)5-14-7-3-1-6(2-4-7)9(12)13/h1-4H,5H2,(H2,10,11)(H,12,13).

What is the InChIKey of 4-(2-amino-2-oxoethoxy)benzoic acid?

The InChIKey is AWIPPDRFNWTGTR-UHFFFAOYSA-N.

What is the canonical SMILES of 4-(2-amino-2-oxoethoxy)benzoic acid?

The canonical SMILES is C1=CC(=CC=C1C(=O)O)OCC(=O)N.

What is the CAS number of 4-(2-amino-2-oxoethoxy)benzoic acid?

The CAS number is 159143-14-3.

What is the EC number of 4-(2-amino-2-oxoethoxy)benzoic acid?

The EC number is 806-344-5.

What is the XLogP3 value of 4-(2-amino-2-oxoethoxy)benzoic acid?

The XLogP3 value is 0.3.

Is 4-(2-amino-2-oxoethoxy)benzoic acid considered a canonicalized compound?

Yes, it is considered a canonicalized compound.