4-(1H-Tetrazol-5-yl)-N-(4-(1H-tetrazol-5-yl)phenyl)benzamide

• CAS: 132640-22-3
• Catalog Number: ACM132640223
• Category: Other Products
• Molecular Weight: 0
• Synonyms: 4-(1H-tetrazol-5-yl)-N-(4-(1H-tetrazol-5-yl)phenyl)benzamide;Benzamide, 4-(2H-tetrazol-5-yl)-N-[4-(2H-tetrazol-5-yl)phenyl]-

Custom Q&A

What is the molecular formula of the compound with PubChem CID 65970?

The molecular formula is C15H11N9O.

What is the molecular weight of the compound?

The molecular weight is 333.31 g/mol.

What is the IUPAC name of the compound?

The IUPAC name is 4-(2H-tetrazol-5-yl)-N-[4-(2H-tetrazol-5-yl)phenyl]benzamide.

What is the InChI of the compound?

The InChI is InChI=1S/C15H11N9O/c25-15(11-3-1-9(2-4-11)13-17-21-22-18-13)16-12-7-5-10(6-8-12)14-19-23-24-20-14/h1-8H,(H,16,25)(H,17,18,21,22)(H,19,20,23,24).

What is the InChIKey of the compound?

The InChIKey is VXEBMQZDPONDFB-UHFFFAOYSA-N.

What is the canonical SMILES of the compound?

The canonical SMILES is C1=CC(=CC=C1C2=NNN=N2)C(=O)NC3=CC=C(C=C3)C4=NNN=N4.

What is the CAS number of the compound?

The CAS number is 132640-22-3.

What is the ChEMBL ID of the compound?

The ChEMBL ID is CHEMBL119549.

What is the hydrogen bond donor count of the compound?

The hydrogen bond donor count is 3.

Is the compound canonicalized?

Yes, the compound is canonicalized.