What is the molecular formula of 4-(1,2,3,6-Tetrahydropyridin-4-yl)phenol hydrochloride?
The molecular formula is C11H14ClNO.
What is the molecular weight of 4-(1,2,3,6-Tetrahydropyridin-4-yl)phenol hydrochloride?
The molecular weight is 211.69 g/mol.
What is the IUPAC name of 4-(1,2,3,6-Tetrahydropyridin-4-yl)phenol hydrochloride?
The IUPAC name is 4-(1,2,3,6-tetrahydropyridin-4-yl)phenol;hydrochloride.
What is the InChI of 4-(1,2,3,6-Tetrahydropyridin-4-yl)phenol hydrochloride?
The InChI is InChI=1S/C11H13NO.ClH/c13-11-3-1-9(2-4-11)10-5-7-12-8-6-10;/h1-5,12-13H,6-8H2;1H.
What is the InChIKey of 4-(1,2,3,6-Tetrahydropyridin-4-yl)phenol hydrochloride?
The InChIKey is ITGZFANLOBAXER-UHFFFAOYSA-N.
What is the canonical SMILES of 4-(1,2,3,6-Tetrahydropyridin-4-yl)phenol hydrochloride?
The canonical SMILES is C1CNCC=C1C2=CC=C(C=C2)O.Cl.
What is the CAS number of 4-(1,2,3,6-Tetrahydropyridin-4-yl)phenol hydrochloride?
The CAS number is 90684-15-4.
What is the hydrogen bond donor count of 4-(1,2,3,6-Tetrahydropyridin-4-yl)phenol hydrochloride?
The hydrogen bond donor count is 3.
What is the hydrogen bond acceptor count of 4-(1,2,3,6-Tetrahydropyridin-4-yl)phenol hydrochloride?
The hydrogen bond acceptor count is 2.
What is the topological polar surface area of 4-(1,2,3,6-Tetrahydropyridin-4-yl)phenol hydrochloride?
The topological polar surface area is 32.3Ų.