3Alpha-hydroxy-2beta-(2z-pentenyl)-cyclopentane-1beta-acetic acid

• CAS: 58240-50-9
• Catalog Number: ACM58240509
• Category: Other Products
• Molecular Weight: 212.29
• Molecular Formula: C₁₂H₂₀O₃
• Synonyms: 3ALPHA-HYDROXY-2BETA-(2Z-PENTENYL)-CYCLOPENTANE-1BETA-ACETIC ACID;CUCURBIC ACID;(1R)-3β-Hydroxy-2α-[(Z)-2-pentenyl]cyclopentane-1α-acetic acid;(1R)-3β-Hydroxy-2α-[(Z)-2-pentenyl]cyclopentaneacetic acid;(+)-CUCURBIC ACID (CA)

Custom Q&A

What is the molecular formula of (+)-cucurbic acid?

The molecular formula of (+)-cucurbic acid is C12H20O3.

What is the molecular weight of (+)-cucurbic acid?

The molecular weight of (+)-cucurbic acid is 212.28 g/mol.

What is the IUPAC name of (+)-cucurbic acid?

The IUPAC name of (+)-cucurbic acid is 2-[(1R,2S,3S)-3-hydroxy-2-[(Z)-pent-2-enyl]cyclopentyl]acetic acid.

What is the InChI of (+)-cucurbic acid?

The InChI of (+)-cucurbic acid is InChI=1S/C12H20O3/c1-2-3-4-5-10-9(8-12(14)15)6-7-11(10)13/h3-4,9-11,13H,2,5-8H2,1H3,(H,14,15)/b4-3-/t9-,10+,11+/m1/s1.

What is the InChIKey of (+)-cucurbic acid?

The InChIKey of (+)-cucurbic acid is LYSGIJUGUGJIPS-UOMVISFLSA-N.

What is the canonical SMILES of (+)-cucurbic acid?

The canonical SMILES of (+)-cucurbic acid is CCC=CCC1C(CCC1O)CC(=O)O.

What is the CAS number of (+)-cucurbic acid?

The CAS number of (+)-cucurbic acid is 58240-50-9.

What is the ChEMBL ID of (+)-cucurbic acid?

The ChEMBL ID of (+)-cucurbic acid is CHEMBL2272539.

How many hydrogen bond donor counts does (+)-cucurbic acid have?

(+)-cucurbic acid has 2 hydrogen bond donor counts.

How many rotatable bond counts does (+)-cucurbic acid have?

(+)-cucurbic acid has 5 rotatable bond counts.