What is the molecular formula of 3-(Trifluoromethoxy)phenylacetylene?
The molecular formula is C9H5F3O.
What is the molecular weight of 3-(Trifluoromethoxy)phenylacetylene?
The molecular weight is 186.13 g/mol.
What is the IUPAC name of 3-(Trifluoromethoxy)phenylacetylene?
The IUPAC name is 1-ethynyl-3-(trifluoromethoxy)benzene.
What is the InChI of 3-(Trifluoromethoxy)phenylacetylene?
The InChI is InChI=1S/C9H5F3O/c1-2-7-4-3-5-8(6-7)13-9(10,11)12/h1,3-6H.
What is the InChIKey of 3-(Trifluoromethoxy)phenylacetylene?
The InChIKey is NWBWKSOPVZODSM-UHFFFAOYSA-N.
What is the canonical SMILES of 3-(Trifluoromethoxy)phenylacetylene?
The canonical SMILES is C#CC1=CC(=CC=C1)OC(F)(F)F.
What is the CAS number of 3-(Trifluoromethoxy)phenylacetylene?
The CAS number is 866683-57-0.
What is the EC number of 3-(Trifluoromethoxy)phenylacetylene?
The EC number is 874-610-8.
What is the molecular weight of 3-(Trifluoromethoxy)phenylacetylene according to PubChem?
The molecular weight is 186.13 g/mol.
Does 3-(Trifluoromethoxy)phenylacetylene have any hydrogen bond donor count according to Cactvs?
No, it has a hydrogen bond donor count of 0 according to Cactvs.