CAS
459856-12-3 Purity
95%
459856-12-3 Purity
95%
Inquiry Basket
3-(Pyrrolidin-1-ylmethyl)phenylboronic acid
CAS
1100095-09-7
Catalog Number
ACM1100095097
Category
Boronic Acids
If you have any other questions or need other size, please get a quote.
- Product Description
- Case Study
- Custom Reviews
- Custom Q&A
- Synthetic Use
- Related Resources
What is the molecular formula of 3-(Pyrrolidin-1-ylmethyl)phenylboronic acid?
The molecular formula of 3-(Pyrrolidin-1-ylmethyl)phenylboronic acid is C11H16BNO2.
What is the molecular weight of 3-(Pyrrolidin-1-ylmethyl)phenylboronic acid?
The molecular weight of 3-(Pyrrolidin-1-ylmethyl)phenylboronic acid is 205.06 g/mol.
What is the IUPAC name of 3-(Pyrrolidin-1-ylmethyl)phenylboronic acid?
The IUPAC name of 3-(Pyrrolidin-1-ylmethyl)phenylboronic acid is [3-(pyrrolidin-1-ylmethyl)phenyl]boronic acid.
What is the InChI of 3-(Pyrrolidin-1-ylmethyl)phenylboronic acid?
The InChI of 3-(Pyrrolidin-1-ylmethyl)phenylboronic acid is InChI=1S/C11H16BNO2/c14-12(15)11-5-3-4-10(8-11)9-13-6-1-2-7-13/h3-5,8,14-15H,1-2,6-7,9H2.
What is the InChIKey of 3-(Pyrrolidin-1-ylmethyl)phenylboronic acid?
The InChIKey of 3-(Pyrrolidin-1-ylmethyl)phenylboronic acid is JRGCMBMTOLSYTF-UHFFFAOYSA-N.
How many hydrogen bond donor counts does 3-(Pyrrolidin-1-ylmethyl)phenylboronic acid have?
3-(Pyrrolidin-1-ylmethyl)phenylboronic acid has 2 hydrogen bond donor counts.
What is the exact mass of 3-(Pyrrolidin-1-ylmethyl)phenylboronic acid?
3-(Pyrrolidin-1-ylmethyl)phenylboronic acid has an exact mass of 205.1274089 g/mol.
How many rotatable bond counts does 3-(Pyrrolidin-1-ylmethyl)phenylboronic acid have?
3-(Pyrrolidin-1-ylmethyl)phenylboronic acid has 3 rotatable bond counts.
What is the topological polar surface area of 3-(Pyrrolidin-1-ylmethyl)phenylboronic acid?
The topological polar surface area of 3-(Pyrrolidin-1-ylmethyl)phenylboronic acid is 43.7 Ų.
Is the compound canonicalized in the PubChem database?
Yes, the compound is canonicalized in the PubChem database.
Recommended Products
