3-Methylmandelic acid

• Catalog Number: ACMA00000501
• Category: Alcohols
• Molecular Weight: 166.17
• Molecular Formula: C₉H₁₀O
• Hazard Statements: H319
• RIDADR: NONH for all modes of transport
• Symbol: GHS07

Custom Q&A

What is the molecular formula of 3-Methylmandelic acid?

The molecular formula of 3-Methylmandelic acid is C9H10O3.

What is the molecular weight of 3-Methylmandelic acid?

The molecular weight of 3-Methylmandelic acid is 166.17 g/mol.

What is the IUPAC name of 3-Methylmandelic acid?

The IUPAC name of 3-Methylmandelic acid is 2-hydroxy-2-(3-methylphenyl)acetic acid.

What is the InChI of 3-Methylmandelic acid?

The InChI of 3-Methylmandelic acid is InChI=1S/C9H10O3/c1-6-3-2-4-7(5-6)8(10)9(11)12/h2-5,8,10H,1H3,(H,11,12).

What is the InChIKey of 3-Methylmandelic acid?

The InChIKey of 3-Methylmandelic acid is ASTGXUHKUFFOQX-UHFFFAOYSA-N.

What is the CAS number of 3-Methylmandelic acid?

The CAS number of 3-Methylmandelic acid is 65148-70-1.

What is the XLogP3 value of 3-Methylmandelic acid?

The XLogP3 value of 3-Methylmandelic acid is 1.

How many hydrogen bond donor counts does 3-Methylmandelic acid have?

3-Methylmandelic acid has 2 hydrogen bond donor counts.

How many rotatable bond counts does 3-Methylmandelic acid have?

3-Methylmandelic acid has 2 rotatable bond counts.

Is 3-Methylmandelic acid the canonicalized compound?

Yes, 3-Methylmandelic acid is the canonicalized compound.