3-(Isodecyloxy)propylamine

• CAS: 30113-45-2
• Catalog Number: ACM30113452
• Category: Other Products
• Molecular Weight: 215.37546
• Molecular Formula: C₁₃H₂₉NO
• Synonyms: 3-(isodecyloxy)propylamine;1-Propanamine, 3-(isodecyloxy)-;3-(Isodecyloxy)-1-propylamine;3-isodecyloxypropanamine;3-(8-Methylnonyloxy)-1-propanamine;3-(Isodesyloxy)-1-propanamine;3-[(Isodesyl)oxy]-1-propanamine;FENTAMINE OPA-10

Custom Q&A

What is the molecular formula of 3-(Isodecyloxy)propylamine?

The molecular formula of 3-(Isodecyloxy)propylamine is C13H29NO.

What is the molecular weight of 3-(Isodecyloxy)propylamine?

The molecular weight of 3-(Isodecyloxy)propylamine is 215.38 g/mol.

What is the IUPAC name of 3-(Isodecyloxy)propylamine?

The IUPAC name of 3-(Isodecyloxy)propylamine is 3-(8-methylnonoxy)propan-1-amine.

What is the InChI of 3-(Isodecyloxy)propylamine?

The InChI of 3-(Isodecyloxy)propylamine is InChI=1S/C13H29NO/c1-13(2)9-6-4-3-5-7-11-15-12-8-10-14/h13H,3-12,14H2,1-2H3.

What is the InChIKey of 3-(Isodecyloxy)propylamine?

The InChIKey of 3-(Isodecyloxy)propylamine is DHIBIUNZWFPELU-UHFFFAOYSA-N.

How many hydrogen bond donor counts does 3-(Isodecyloxy)propylamine have?

3-(Isodecyloxy)propylamine has 1 hydrogen bond donor count.

How many hydrogen bond acceptor counts does 3-(Isodecyloxy)propylamine have?

3-(Isodecyloxy)propylamine has 2 hydrogen bond acceptor counts.

What is the topological polar surface area of 3-(Isodecyloxy)propylamine?

The topological polar surface area of 3-(Isodecyloxy)propylamine is 35.2 Ų.

Is 3-(Isodecyloxy)propylamine a canonicalized compound?

Yes, 3-(Isodecyloxy)propylamine is a canonicalized compound.

What is the CAS number of 3-(Isodecyloxy)propylamine?

The CAS number of 3-(Isodecyloxy)propylamine is 30113-45-2.