3-Hexyn-2-ol

• CAS: 109-50-2
• Catalog Number: ACM109502
• Category: Alkynes
• Molecular Weight: 98.14
• Molecular Formula: C₆H₉I
• Hazard Statements: H225
• RIDADR: UN 3295BF 3 / PGII
• Symbol: GHS02

Custom Q&A

What is the molecular formula of the compound?

The molecular formula of the compound is C6H10O.

What is the molecular weight of the compound?

The molecular weight of the compound is 98.14 g/mol.

What is the IUPAC name of the compound?

The IUPAC name of the compound is hex-3-yn-2-ol.

What is the InChI of the compound?

The InChI of the compound is InChI=1S/C6H10O/c1-3-4-5-6(2)7/h6-7H,3H2,1-2H3.

What is the InChIKey of the compound?

The InChIKey of the compound is IFCAMPHNVKBSTF-UHFFFAOYSA-N.

What is the Canonical SMILES of the compound?

The Canonical SMILES of the compound is CCC#CC(C)O.

What is the CAS number of the compound?

The CAS number of the compound is 109-50-2.

What is the European Community (EC) number of the compound?

The European Community (EC) number of the compound is 203-676-7.

What is the XLogP3-AA value of the compound?

The XLogP3-AA value of the compound is 1.

Is the compound canonically defined?

Yes, the compound is canonically defined.