3-Formylphenyl 4-methoxybenzoate

• Catalog Number: ACMA00002532
• Category: Ethers
• Molecular Weight: 256.25
• Molecular Formula: C₁₅H₁₂O₃
• Hazard Statements: H318
• RIDADR: NONH for all modes of transport
• Symbol: GHS05

Custom Q&A

What is the molecular formula of 3-Formylphenyl 4-methoxybenzoate?

The molecular formula of 3-Formylphenyl 4-methoxybenzoate is C15H12O4.

What is the molecular weight of 3-Formylphenyl 4-methoxybenzoate?

The molecular weight of 3-Formylphenyl 4-methoxybenzoate is 256.25 g/mol.

What is the IUPAC name of 3-Formylphenyl 4-methoxybenzoate?

The IUPAC name of 3-Formylphenyl 4-methoxybenzoate is (3-formylphenyl) 4-methoxybenzoate.

What is the InChI of 3-Formylphenyl 4-methoxybenzoate?

The InChI of 3-Formylphenyl 4-methoxybenzoate is InChI=1S/C15H12O4/c1-18-13-7-5-12(6-8-13)15(17)19-14-4-2-3-11(9-14)10-16/h2-10H,1H3.

What is the InChIKey of 3-Formylphenyl 4-methoxybenzoate?

The InChIKey of 3-Formylphenyl 4-methoxybenzoate is AZDDZTAYYQDDSA-UHFFFAOYSA-N.

What is the canonical SMILES of 3-Formylphenyl 4-methoxybenzoate?

The canonical SMILES of 3-Formylphenyl 4-methoxybenzoate is COC1=CC=C(C=C1)C(=O)OC2=CC=CC(=C2)C=O.

What is the XLogP3 value of 3-Formylphenyl 4-methoxybenzoate?

The XLogP3 value of 3-Formylphenyl 4-methoxybenzoate is 3.

How many hydrogen bond donor counts does 3-Formylphenyl 4-methoxybenzoate have?

3-Formylphenyl 4-methoxybenzoate has 0 hydrogen bond donor counts.

How many hydrogen bond acceptor counts does 3-Formylphenyl 4-methoxybenzoate have?

3-Formylphenyl 4-methoxybenzoate has 4 hydrogen bond acceptor counts.

How many rotatable bond counts does 3-Formylphenyl 4-methoxybenzoate have?

3-Formylphenyl 4-methoxybenzoate has 5 rotatable bond counts.