3-Fluoro-4-(trifluoromethyl)benzaldehyde

• Catalog Number: ACMA00001833
• Category: Aryl Fluorinated Building Blocks
• Molecular Weight: 192.11
• Molecular Formula: C₈H₃F₂NO
• Hazard Statements: H315-H319-H335
• RIDADR: NONH for all modes of transport
• Symbol: GHS07

Custom Q&A

What is the molecular formula of 3-Fluoro-4-(trifluoromethyl)benzaldehyde?

The molecular formula of 3-Fluoro-4-(trifluoromethyl)benzaldehyde is C8H4F4O.

When was the compound first created?

The compound was first created on July 19, 2005.

What is the molecular weight of 3-Fluoro-4-(trifluoromethyl)benzaldehyde?

The molecular weight is 192.11 g/mol.

What is the IUPAC name of the compound?

The IUPAC name of 3-Fluoro-4-(trifluoromethyl)benzaldehyde is 3-fluoro-4-(trifluoromethyl)benzaldehyde.

What is the canonical SMILES for the compound?

The canonical SMILES is C1=CC(=C(C=C1C=O)F)C(F)(F)F.

What is the InChIKey of the compound?

The InChIKey is ZVIQXFUBNNGOJY-UHFFFAOYSA-N.

How many hydrogen bond acceptor counts does the compound have?

The compound has 5 hydrogen bond acceptor counts.

What is the topological polar surface area of the compound?

The topological polar surface area is 17.1 2.

Does the compound have any defined atom stereocenter count?

No, the compound does not have any defined atom stereocenter count.

Is the compound canonicalized?

Yes, the compound is canonicalized.