What is the molecular formula of 3-Fluoro-4-nitrobenzenesulfonyl chloride?
The molecular formula is C6H3ClFNO4S.
What is the molecular weight of 3-Fluoro-4-nitrobenzenesulfonyl chloride?
The molecular weight is 239.61 g/mol.
When was 3-Fluoro-4-nitrobenzenesulfonyl chloride created in PubChem?
It was created on February 12, 2007.
What is the IUPAC name of 3-Fluoro-4-nitrobenzenesulfonyl chloride?
The IUPAC name is 3-fluoro-4-nitrobenzenesulfonyl chloride.
Can you provide the InChI of 3-Fluoro-4-nitrobenzenesulfonyl chloride?
The InChI is InChI=1S/C6H3ClFNO4S/c7-14(12,13)4-1-2-6(9(10)11)5(8)3-4/h1-3H.
What is the InChIKey of 3-Fluoro-4-nitrobenzenesulfonyl chloride?
The InChIKey is AAWFUSFNPBRQDE-UHFFFAOYSA-N.
What is the canonical SMILES of 3-Fluoro-4-nitrobenzenesulfonyl chloride?
The canonical SMILES is C1=CC(=C(C=C1S(=O)(=O)Cl)F)[N+](=O)[O-].
What is the CAS number of 3-Fluoro-4-nitrobenzenesulfonyl chloride?
The CAS number is 86156-93-6.
What is the EC number of 3-Fluoro-4-nitrobenzenesulfonyl chloride?
The EC number is 679-316-1.
What is the molecular weight of 3-Fluoro-4-nitrobenzenesulfonyl chloride according to PubChem?
The molecular weight is 239.61 g/mol, computed by PubChem 2.1.