What is the molecular formula of 3-Fluoro-4-(methylcarbamoyl)phenylboronic acid?
The molecular formula is C8H9BFNO3.
What is the molecular weight of 3-Fluoro-4-(methylcarbamoyl)phenylboronic acid?
The molecular weight is 196.97 g/mol.
What is the IUPAC name of 3-Fluoro-4-(methylcarbamoyl)phenylboronic acid?
The IUPAC name is [3-fluoro-4-(methylcarbamoyl)phenyl]boronic acid.
What is the InChI of 3-Fluoro-4-(methylcarbamoyl)phenylboronic acid?
The InChI is InChI=1S/C8H9BFNO3/c1-11-8(12)6-3-2-5(9(13)14)4-7(6)10/h2-4,13-14H,1H3,(H,11,12).
What is the InChIKey of 3-Fluoro-4-(methylcarbamoyl)phenylboronic acid?
The InChIKey is IVSXSBGNMOZTJR-UHFFFAOYSA-N.
What is the canonical SMILES of 3-Fluoro-4-(methylcarbamoyl)phenylboronic acid?
The canonical SMILES is B(C1=CC(=C(C=C1)C(=O)NC)F)(O)O.
What is the CAS number of 3-Fluoro-4-(methylcarbamoyl)phenylboronic acid?
The CAS number is 849833-86-9.
What is the European Community (EC) number of 3-Fluoro-4-(methylcarbamoyl)phenylboronic acid?
The EC number is 691-000-5.
What is the monoisotopic mass of 3-Fluoro-4-(methylcarbamoyl)phenylboronic acid?
The monoisotopic mass is 197.0659515 g/mol.
Is 3-Fluoro-4-(methylcarbamoyl)phenylboronic acid a canonicalized compound?
Yes, it is a canonicalized compound.