3-Fluoro-4-hydroxy-5-methoxybenzaldehyde

• CAS: 79418-78-3
• Catalog Number: ACM79418783
• Category: Aryl Fluorinated Building Blocks
• Molecular Weight: 170.14
• Hazard Statements: H315-H319-H335
• RIDADR: NONH for all modes of transport
• Symbol: GHS07

Custom Q&A

What is the molecular formula of 3-Fluoro-4-hydroxy-5-methoxybenzaldehyde?

The molecular formula is C8H7FO3.

What is the IUPAC name of 3-Fluoro-4-hydroxy-5-methoxybenzaldehyde?

The IUPAC name is 3-fluoro-4-hydroxy-5-methoxybenzaldehyde.

What is the InChI of 3-Fluoro-4-hydroxy-5-methoxybenzaldehyde?

The InChI is InChI=1S/C8H7FO3/c1-12-7-3-5(4-10)2-6(9)8(7)11/h2-4,11H,1H3.

What is the InChIKey of 3-Fluoro-4-hydroxy-5-methoxybenzaldehyde?

The InChIKey is OOGOFUKAJDPHDJ-UHFFFAOYSA-N.

What is the canonical SMILES of 3-Fluoro-4-hydroxy-5-methoxybenzaldehyde?

The canonical SMILES is COC1=C(C(=CC(=C1)C=O)F)O.

What is the CAS number of 3-Fluoro-4-hydroxy-5-methoxybenzaldehyde?

The CAS number is 79418-78-3.

What is the molecular weight of 3-Fluoro-4-hydroxy-5-methoxybenzaldehyde?

The molecular weight is 170.14 g/mol.

What is the XLogP3-AA value of 3-Fluoro-4-hydroxy-5-methoxybenzaldehyde?

The XLogP3-AA value is 1.1.

How many hydrogen bond donor atoms are there in 3-Fluoro-4-hydroxy-5-methoxybenzaldehyde?

There is one hydrogen bond donor atom in 3-Fluoro-4-hydroxy-5-methoxybenzaldehyde.

How many hydrogen bond acceptor atoms are there in 3-Fluoro-4-hydroxy-5-methoxybenzaldehyde?

There are four hydrogen bond acceptor atoms in 3-Fluoro-4-hydroxy-5-methoxybenzaldehyde.