3-Chloro-but-2-enylamine

• Catalog Number: ACMA00000640
• Category: Alkenyl
• Molecular Weight: 105.57
• Hazard Statements: H225
• RIDADR: UN 2554 3 / PGII
• Symbol: GHS02

Custom Q&A

What is the PubChem CID of 3-Chloro-but-2-enylamine?

PubChem CID 44890758.

What is the molecular formula of 3-Chloro-but-2-enylamine?

The molecular formula is C4H9Cl2N.

What is the molecular weight of 3-Chloro-but-2-enylamine?

The molecular weight is 142.02 g/mol.

What is the IUPAC name of 3-Chloro-but-2-enylamine?

The IUPAC name is (Z)-3-chlorobut-2-en-1-amine;hydrochloride.

What is the InChI of 3-Chloro-but-2-enylamine?

The InChI is InChI=1S/C4H8ClN.ClH/c1-4(5)2-3-6;/h2H,3,6H2,1H3;1H/b4-2-.

What is the InChIKey of 3-Chloro-but-2-enylamine?

The InChIKey is FNXILSDJRCHUDK-MKHFZPSSSA-N.

What is the canonical SMILES of 3-Chloro-but-2-enylamine?

The canonical SMILES is CC(=CCN)Cl.Cl.

What is the isomeric SMILES of 3-Chloro-but-2-enylamine?

The isomeric SMILES is C/C(=C/CN)/Cl.Cl.

How many hydrogen bond donor count does 3-Chloro-but-2-enylamine have?

It has 2 hydrogen bond donor counts.

How many hydrogen bond acceptor count does 3-Chloro-but-2-enylamine have?

It has 1 hydrogen bond acceptor count.