3-Chloro-2-formylbenzonitrile

• CAS: 1256561-76-8
• Catalog Number: ACM1256561768
• Category: Other Products
• Molecular Weight: 165.57646
• Molecular Formula: C₈H₄ClNO
• Synonyms: 3-chloro-2-forMylbenzonitrile

Custom Q&A

What is the molecular formula of 3-Chloro-2-formylbenzonitrile?

The molecular formula of 3-Chloro-2-formylbenzonitrile is C8H4ClNO.

What is the molecular weight of 3-Chloro-2-formylbenzonitrile?

The molecular weight of 3-Chloro-2-formylbenzonitrile is 165.57 g/mol.

When was 3-Chloro-2-formylbenzonitrile created on PubChem?

3-Chloro-2-formylbenzonitrile was created on August 20, 2012.

What is the Canonical SMILES notation for 3-Chloro-2-formylbenzonitrile?

The Canonical SMILES notation for 3-Chloro-2-formylbenzonitrile is C1=CC(=C(C(=C1)Cl)C=O)C#N.

How many hydrogen bond acceptor counts does 3-Chloro-2-formylbenzonitrile have?

3-Chloro-2-formylbenzonitrile has 2 hydrogen bond acceptor counts.

What is the exact mass of 3-Chloro-2-formylbenzonitrile?

The exact mass of 3-Chloro-2-formylbenzonitrile is 164.9981414 g/mol.

Is 3-Chloro-2-formylbenzonitrile considered as a canonicalized compound on PubChem?

Yes, 3-Chloro-2-formylbenzonitrile is considered as a canonicalized compound on PubChem.

What is the topological polar surface area of 3-Chloro-2-formylbenzonitrile?

The topological polar surface area of 3-Chloro-2-formylbenzonitrile is 40.9 Ų.

How many heavy atoms are present in the structure of 3-Chloro-2-formylbenzonitrile?

There are 11 heavy atoms in the structure of 3-Chloro-2-formylbenzonitrile.

How many rotatable bonds does 3-Chloro-2-formylbenzonitrile have?

3-Chloro-2-formylbenzonitrile has 1 rotatable bond.