CAS
--- Purity
---
--- Purity
---
Inquiry Basket
3-Chloro-2-fluorophenylacetic acid
Catalog Number
ACMA00001958
Category
Aryl Fluorinated Building Blocks
Molecular Weight
188.58
Molecular Formula
C8H6ClFO2
If you have any other questions or need other size, please get a quote.
- Product Description
- Case Study
- Custom Reviews
- Custom Q&A
- Synthetic Use
- Related Resources
Specification
Hazard Statements
H302
RIDADR
NONH for all modes of transport
Symbol
GHS07
What is the molecular formula of 3-Chloro-2-fluorophenylacetic acid?
The molecular formula of 3-Chloro-2-fluorophenylacetic acid is C8H6ClFO2.
What is the molecular weight of 3-Chloro-2-fluorophenylacetic acid?
The molecular weight of 3-Chloro-2-fluorophenylacetic acid is 188.58 g/mol.
What is the IUPAC name of 3-Chloro-2-fluorophenylacetic acid?
The IUPAC name of 3-Chloro-2-fluorophenylacetic acid is 2-(3-chloro-2-fluorophenyl)acetic acid.
What is the InChI of 3-Chloro-2-fluorophenylacetic acid?
The InChI of 3-Chloro-2-fluorophenylacetic acid is InChI=1S/C8H6ClFO2/c9-6-3-1-2-5(8(6)10)4-7(11)12/h1-3H,4H2,(H,11,12).
What is the InChIKey of 3-Chloro-2-fluorophenylacetic acid?
The InChIKey of 3-Chloro-2-fluorophenylacetic acid is LBGHWXGWKTZILK-UHFFFAOYSA-N.
How many hydrogen bond donor counts does 3-Chloro-2-fluorophenylacetic acid have?
3-Chloro-2-fluorophenylacetic acid has 1 hydrogen bond donor count.
How many hydrogen bond acceptor counts does 3-Chloro-2-fluorophenylacetic acid have?
3-Chloro-2-fluorophenylacetic acid has 3 hydrogen bond acceptor counts.
What is the topological polar surface area of 3-Chloro-2-fluorophenylacetic acid?
The topological polar surface area of 3-Chloro-2-fluorophenylacetic acid is 37.3 Ų.
Is 3-Chloro-2-fluorophenylacetic acid a canonicalized compound?
Yes, 3-Chloro-2-fluorophenylacetic acid is a canonicalized compound.
What is the complexity value of 3-Chloro-2-fluorophenylacetic acid?
The complexity value of 3-Chloro-2-fluorophenylacetic acid is 174.
Recommended Products
