3-Buten-2-ol

• CAS: 598-32-3
• Catalog Number: ACM598323
• Category: Alkenes
• Molecular Weight: 72.11
• Molecular Formula: C₄H₈O
• Hazard Statements: H226-H315-H319-H335
• RIDADR: UN 1987C 3 / PGIII
• Symbol: GHS02

Custom Q&A

What is the IUPAC name of the compound?

The IUPAC name of the compound is but-3-en-2-ol.

What is the molecular formula of the compound?

The molecular formula of the compound is C4H8O.

What is the molecular weight of the compound?

The molecular weight of the compound is 72.11 g/mol.

What is the InChI of the compound?

The InChI of the compound is InChI=1S/C4H8O/c1-3-4(2)5/h3-5H,1H2,2H3.

What is the InChIKey of the compound?

The InChIKey of the compound is MKUWVMRNQOOSAT-UHFFFAOYSA-N.

What is the canonical SMILES of the compound?

The canonical SMILES of the compound is CC(C=C)O.

What is the CAS number of the compound?

The CAS number of the compound is 598-32-3.

What is the XLogP3-AA value of the compound?

The XLogP3-AA value of the compound is 0.6.

How many hydrogen bond donor counts does the compound have?

The compound has 1 hydrogen bond donor count.

How many hydrogen bond acceptor counts does the compound have?

The compound has 1 hydrogen bond acceptor count.