3-Bromonaphthalene-2-carboxaldehyde

• CAS: 89005-11-8
• Catalog Number: ACM89005118
• Category: Other Products
• Molecular Weight: 235.07668
• Molecular Formula: C₁₁H₇BrO
• Synonyms: 3-Bromonaphthalene-2-carboxaldehyde;3-broMo-2-naphthaldehyde;3-Bromo-2-naphthalenecarboxaldehyde;3-Bromo-naphthalene-2-carbaldehyde

Custom Q&A

What is the molecular formula of 3-Bromonaphthalene-2-carboxaldehyde?

The molecular formula of 3-Bromonaphthalene-2-carboxaldehyde is C11H7BrO.

What is the molecular weight of 3-Bromonaphthalene-2-carboxaldehyde?

The molecular weight of 3-Bromonaphthalene-2-carboxaldehyde is 235.08 g/mol.

What is the IUPAC name of 3-Bromonaphthalene-2-carboxaldehyde?

The IUPAC name of 3-Bromonaphthalene-2-carboxaldehyde is 3-bromonaphthalene-2-carbaldehyde.

What is the InChI of 3-Bromonaphthalene-2-carboxaldehyde?

The InChI of 3-Bromonaphthalene-2-carboxaldehyde is InChI=1S/C11H7BrO/c12-11-6-9-4-2-1-3-8(9)5-10(11)7-13/h1-7H.

What is the InChIKey of 3-Bromonaphthalene-2-carboxaldehyde?

The InChIKey of 3-Bromonaphthalene-2-carboxaldehyde is ZKTRKPUSTOGJMJ-UHFFFAOYSA-N.

What is the canonical SMILES of 3-Bromonaphthalene-2-carboxaldehyde?

The canonical SMILES of 3-Bromonaphthalene-2-carboxaldehyde is C1=CC=C2C=C(C(=CC2=C1)C=O)Br.

What is the CAS number of 3-Bromonaphthalene-2-carboxaldehyde?

The CAS number of 3-Bromonaphthalene-2-carboxaldehyde is 89005-11-8.

How many hydrogen bond donor atoms are in 3-Bromonaphthalene-2-carboxaldehyde?

There are 0 hydrogen bond donor atoms in 3-Bromonaphthalene-2-carboxaldehyde.

How many hydrogen bond acceptor atoms are in 3-Bromonaphthalene-2-carboxaldehyde?

There is 1 hydrogen bond acceptor atom in 3-Bromonaphthalene-2-carboxaldehyde.