What is the molecular formula of 3-Bromo-6-Chloro-2-fluorophenylboronic acid pinacol ester?
The molecular formula is C12H14BBrClFO2.
What is the molecular weight of 3-Bromo-6-Chloro-2-fluorophenylboronic acid pinacol ester?
The molecular weight is 335.41 g/mol.
When was 3-Bromo-6-Chloro-2-fluorophenylboronic acid pinacol ester created?
It was created on July 1, 2014.
When was 3-Bromo-6-Chloro-2-fluorophenylboronic acid pinacol ester last modified?
It was last modified on December 2, 2023.
What is the IUPAC name of 3-Bromo-6-Chloro-2-fluorophenylboronic acid pinacol ester?
The IUPAC name is 2-(3-bromo-6-chloro-2-fluorophenyl)-4,4,5,5-tetramethyl-1,3,2-dioxaborolane.
What is the InChI of 3-Bromo-6-Chloro-2-fluorophenylboronic acid pinacol ester?
The InChI is InChI=1S/C12H14BBrClFO2/c1-11(2)12(3,4)18-13(17-11)9-8(15)6-5-7(14)10(9)16/h5-6H,1-4H3.
What is the InChIKey of 3-Bromo-6-Chloro-2-fluorophenylboronic acid pinacol ester?
The InChIKey is KYWBYZAWFOMLMJ-UHFFFAOYSA-N.
What is the canonical SMILES of 3-Bromo-6-Chloro-2-fluorophenylboronic acid pinacol ester?
The canonical SMILES is B1(OC(C(O1)(C)C)(C)C)C2=C(C=CC(=C2F)Br)Cl.
How many hydrogen bond donor counts does 3-Bromo-6-Chloro-2-fluorophenylboronic acid pinacol ester have?
It has 0 hydrogen bond donor counts.
How many hydrogen bond acceptor counts does 3-Bromo-6-Chloro-2-fluorophenylboronic acid pinacol ester have?
It has 3 hydrogen bond acceptor counts.