3-Bromo-5-methoxypyridine

• CAS: 50720-12-2
• Catalog Number: ACM50720122
• Category: Bromine Series
• Molecular Weight: 188.02
• Molecular Formula: C₆H₆BrNO

Custom Q&A

What is the molecular formula of 3-Bromo-5-methoxypyridine?

The molecular formula of 3-Bromo-5-methoxypyridine is C6H6BrNO.

What is the molecular weight of 3-Bromo-5-methoxypyridine?

The molecular weight of 3-Bromo-5-methoxypyridine is 188.02 g/mol.

What is the IUPAC name of 3-Bromo-5-methoxypyridine?

The IUPAC name of 3-Bromo-5-methoxypyridine is 3-bromo-5-methoxypyridine.

What is the InChI of 3-Bromo-5-methoxypyridine?

The InChI of 3-Bromo-5-methoxypyridine is InChI=1S/C6H6BrNO/c1-9-6-2-5(7)3-8-4-6/h2-4H,1H3.

What is the InChIKey of 3-Bromo-5-methoxypyridine?

The InChIKey of 3-Bromo-5-methoxypyridine is FZWUIWQMJFAWJW-UHFFFAOYSA-N.

What is the canonical SMILES of 3-Bromo-5-methoxypyridine?

The canonical SMILES of 3-Bromo-5-methoxypyridine is COC1=CC(=CN=C1)Br.

What is the CAS number of 3-Bromo-5-methoxypyridine?

The CAS number of 3-Bromo-5-methoxypyridine is 50720-12-2.

What is the EC number of 3-Bromo-5-methoxypyridine?

The EC number of 3-Bromo-5-methoxypyridine is 629-553-1.

What is the monoisotopic mass of 3-Bromo-5-methoxypyridine?

The monoisotopic mass of 3-Bromo-5-methoxypyridine is 186.96328 g/mol.

Is 3-Bromo-5-methoxypyridine a canonicalized compound?

Yes, 3-Bromo-5-methoxypyridine is a canonicalized compound.