CAS
327-75-3 Purity
---
327-75-3 Purity
---
Inquiry Basket
3-Bromo-4-fluoroaniline
CAS
656-64-4
Catalog Number
ACM656644
Category
Bromine Series
If you have any other questions or need other size, please get a quote.
- Product Description
- Case Study
- Custom Reviews
- Custom Q&A
- Synthetic Use
- Related Resources
What is the IUPAC Name of the compound?
The IUPAC name of the compound is 3-bromo-4-fluoroaniline.
What is the molecular formula of the compound?
The molecular formula of the compound is C6H5BrFN.
What is the molecular weight of the compound?
The molecular weight of the compound is 190.01 g/mol.
What is the InChI of the compound?
The InChI of the compound is InChI=1S/C6H5BrFN/c7-5-3-4(9)1-2-6(5)8/h1-3H,9H2.
What is the InChIKey of the compound?
The InChIKey of the compound is KOWPUNQBGWIERF-UHFFFAOYSA-N.
What is the Canonical SMILES of the compound?
The Canonical SMILES of the compound is C1=CC(=C(C=C1N)Br)F.
What is the CAS number of the compound?
The CAS number of the compound is 656-64-4.
What is the XLogP3 value of the compound?
The XLogP3 value of the compound is 2.1.
How many hydrogen bond donor counts does the compound have?
The compound has 1 hydrogen bond donor count.
How many hydrogen bond acceptor counts does the compound have?
The compound has 2 hydrogen bond acceptor counts.
Recommended Products
