3-Bromo-2-hydroxy-5-nitropyridine

• CAS: 15862-33-6
• Catalog Number: ACM15862336
• Category: Bromine Series
• Molecular Weight: 218.99
• Molecular Formula: C₅H₃N₂O₃Br

Custom Q&A

What is the molecular formula of 3-Bromo-2-hydroxy-5-nitropyridine?

The molecular formula is C5H3BrN2O3.

What is the molecular weight of 3-Bromo-2-hydroxy-5-nitropyridine?

The molecular weight is 218.99 g/mol.

What is the IUPAC name of 3-Bromo-2-hydroxy-5-nitropyridine?

The IUPAC name is 3-bromo-5-nitro-1H-pyridin-2-one.

What is the InChI of 3-Bromo-2-hydroxy-5-nitropyridine?

The InChI is "InChI=1S/C5H3BrN2O3/c6-4-1-3(8(10)11)2-7-5(4)9/h1-2H,(H,7,9)".

What is the InChIKey of 3-Bromo-2-hydroxy-5-nitropyridine?

The InChIKey is "KWSOHRDMTWDAOI-UHFFFAOYSA-N".

What is the canonical SMILES of 3-Bromo-2-hydroxy-5-nitropyridine?

The canonical SMILES is "C1=C(C(=O)NC=C1[N+](=O)[O-])Br".

What is the CAS number of 3-Bromo-2-hydroxy-5-nitropyridine?

The CAS number is 15862-33-6.

How many hydrogen bond donor counts does 3-Bromo-2-hydroxy-5-nitropyridine have?

It has one hydrogen bond donor count.

How many hydrogen bond acceptor counts does 3-Bromo-2-hydroxy-5-nitropyridine have?

It has three hydrogen bond acceptor counts.