CAS
--- Purity
---
--- Purity
---
Inquiry Basket
3-Bromo-2-fluorobenzaldehyde
Catalog Number
ACMA00001951
Category
Aryl Fluorinated Building Blocks
Molecular Weight
203.01
If you have any other questions or need other size, please get a quote.
- Product Description
- Case Study
- Custom Reviews
- Custom Q&A
- Synthetic Use
- Related Resources
Specification
Hazard Statements
H302
RIDADR
NONH for all modes of transport
Symbol
GHS07
What is the molecular formula of 3-Bromo-2-fluorobenzaldehyde?
The molecular formula of 3-Bromo-2-fluorobenzaldehyde is C7H4BrFO.
What is the molecular weight of 3-Bromo-2-fluorobenzaldehyde?
The molecular weight of 3-Bromo-2-fluorobenzaldehyde is 203.01 g/mol.
What is the IUPAC name of 3-Bromo-2-fluorobenzaldehyde?
The IUPAC name of 3-Bromo-2-fluorobenzaldehyde is 3-bromo-2-fluorobenzaldehyde.
What is the InChI of 3-Bromo-2-fluorobenzaldehyde?
The InChI of 3-Bromo-2-fluorobenzaldehyde is InChI=1S/C7H4BrFO/c8-6-3-1-2-5(4-10)7(6)9/h1-4H.
What is the InChIKey of 3-Bromo-2-fluorobenzaldehyde?
The InChIKey of 3-Bromo-2-fluorobenzaldehyde is OUAZPCKRSSEQKB-UHFFFAOYSA-N.
How many hydrogen bond acceptor counts does 3-Bromo-2-fluorobenzaldehyde have?
3-Bromo-2-fluorobenzaldehyde has 2 hydrogen bond acceptor counts.
What is the topological polar surface area of 3-Bromo-2-fluorobenzaldehyde?
The topological polar surface area of 3-Bromo-2-fluorobenzaldehyde is 17.1 Ų.
Is 3-Bromo-2-fluorobenzaldehyde a canonicalized compound?
Yes, 3-Bromo-2-fluorobenzaldehyde is a canonicalized compound.
How many defined atom stereocenter counts does 3-Bromo-2-fluorobenzaldehyde have?
3-Bromo-2-fluorobenzaldehyde has 0 defined atom stereocenter counts.
Is there an EC number associated with 3-Bromo-2-fluorobenzaldehyde?
Yes, the European Community (EC) number for 3-Bromo-2-fluorobenzaldehyde is 687-163-7.
Recommended Products
