3-Bromo-2-chloro-5-nitropyridine

• CAS: 5470-17-7
• Catalog Number: ACM5470177
• Category: Bromine Series
• Molecular Weight: 237.44
• Molecular Formula: C₅H₂N₂O₂BrCl

Custom Q&A

What is the molecular formula of 3-Bromo-2-chloro-5-nitropyridine?

The molecular formula is C5H2BrClN2O2.

What is the molecular weight of 3-Bromo-2-chloro-5-nitropyridine?

The molecular weight is 237.44 g/mol.

What is the IUPAC name of 3-Bromo-2-chloro-5-nitropyridine?

The IUPAC name is 3-bromo-2-chloro-5-nitropyridine.

What is the InChI of 3-Bromo-2-chloro-5-nitropyridine?

The InChI is InChI=1S/C5H2BrClN2O2/c6-4-1-3(9(10)11)2-8-5(4)7/h1-2H.

What is the InChIKey of 3-Bromo-2-chloro-5-nitropyridine?

The InChIKey is PTTQIUHVDDBART-UHFFFAOYSA-N.

What is the canonical SMILES of 3-Bromo-2-chloro-5-nitropyridine?

The canonical SMILES is C1=C(C=NC(=C1Br)Cl)[N+](=O)[O-].

What is the CAS number of 3-Bromo-2-chloro-5-nitropyridine?

The CAS number is 5470-17-7.

What is the European Community (EC) number of 3-Bromo-2-chloro-5-nitropyridine?

The European Community (EC) number is 640-176-1.

What is the Nikkaji Number of 3-Bromo-2-chloro-5-nitropyridine?

The Nikkaji Number is J3.457.219D.

What is the topological polar surface area of 3-Bromo-2-chloro-5-nitropyridine?

The topological polar surface area is 58.7Ų.