3-Biphenyl-[1,3]dioxol-5-yl-carboxylic acid

• Catalog Number: ACMA00002472
• Category: Ethers
• Molecular Weight: 242.23
• Molecular Formula: C₁₄H₁₀Cl₂O₂
• Hazard Statements: H302
• RIDADR: NONH for all modes of transport
• Symbol: GHS07

Custom Q&A

What is the PubChem CID of the compound?

The PubChem CID of the compound is 2756678.

What is the molecular formula of the compound?

The molecular formula of the compound is C14H10O4.

What is the molecular weight of the compound?

The molecular weight of the compound is 242.23 g/mol.

What is the IUPAC name of the compound?

The IUPAC name of the compound is 3-(1,3-benzodioxol-5-yl)benzoic acid.

What is the InChI code of the compound?

The InChI code of the compound is InChI=1S/C14H10O4/c15-14(16)11-3-1-2-9(6-11)10-4-5-12-13(7-10)18-8-17-12/h1-7H,8H2,(H,15,16).

What is the InChIKey of the compound?

The InChIKey of the compound is KMYXCUZMLVHANR-UHFFFAOYSA-N.

What is the canonical SMILES of the compound?

The canonical SMILES of the compound is C1OC2=C(O1)C=C(C=C2)C3=CC(=CC=C3)C(=O)O.

What is the CAS number of the compound?

The CAS number of the compound is 24351-56-2.

What is the XLogP3-AA value of the compound?

The XLogP3-AA value of the compound is 2.9.

Is the compound canonicalized?

Yes, the compound is canonicalized.