3-Biphenyl-[1,3]dioxol-5-yl-acetic acid

• Catalog Number: ACMA00002538
• Category: Ethers
• Molecular Weight: 256.25
• Molecular Formula: C₁₅H₁₁F₃O₂
• Hazard Statements: H319
• RIDADR: NONH for all modes of transport
• Symbol: GHS07

Custom Q&A

What is the molecular formula of the compound?

The molecular formula of the compound is C15H12O4.

What are the synonyms of the compound?

The synonyms of the compound are:
3-Biphenyl-[1,3]dioxol-5-yl-acetic acid
669713-75-1
2-(3-(Benzo[d][1,3]dioxol-5-yl)phenyl)acetic acid
2-[3-(1,3-benzodioxol-5-yl)phenyl]acetic acid
3-(1,3-Benzodioxol-5-yl)benzeneacetic acid

What is the molecular weight of the compound?

The molecular weight of the compound is 256.25 g/mol.

What is the IUPAC name of the compound?

The IUPAC name of the compound is 2-[3-(1,3-benzodioxol-5-yl)phenyl]acetic acid.

What is the InChIKey of the compound?

The InChIKey of the compound is HDZYSLBSWPPUJY-UHFFFAOYSA-N.

What is the Canonical SMILES of the compound?

The Canonical SMILES of the compound is C1OC2=C(O1)C=C(C=C2)C3=CC=CC(=C3)CC(=O)O.

What is the XLogP3 of the compound?

The XLogP3 of the compound is 3.

How many hydrogen bond donor counts does the compound have?

The compound has 1 hydrogen bond donor count.

How many hydrogen bond acceptor counts does the compound have?

The compound has 4 hydrogen bond acceptor counts.

How many rotatable bond counts does the compound have?

The compound has 3 rotatable bond counts.