What is the molecular formula of 3-(Aminocarbonyl)-5-fluorophenylboronic acid?
The molecular formula is C7H7BFNO3.
What is the molecular weight of 3-(Aminocarbonyl)-5-fluorophenylboronic acid?
The molecular weight is 182.95 g/mol.
What is the IUPAC name of 3-(Aminocarbonyl)-5-fluorophenylboronic acid?
The IUPAC name is (3-carbamoyl-5-fluorophenyl)boronic acid.
What is the InChI of 3-(Aminocarbonyl)-5-fluorophenylboronic acid?
The InChI is InChI=1S/C7H7BFNO3/c9-6-2-4(7(10)11)1-5(3-6)8(12)13/h1-3,12-13H,(H2,10,11).
What is the InChIKey of 3-(Aminocarbonyl)-5-fluorophenylboronic acid?
The InChIKey is FTMWTTRIUYYHDE-UHFFFAOYSA-N.
What is the canonical SMILES of 3-(Aminocarbonyl)-5-fluorophenylboronic acid?
The canonical SMILES is B(C1=CC(=CC(=C1)F)C(=O)N)(O)O.
What is the CAS number of 3-(Aminocarbonyl)-5-fluorophenylboronic acid?
The CAS number is 871332-66-0.
What is the European Community (EC) number of 3-(Aminocarbonyl)-5-fluorophenylboronic acid?
The EC number is 873-878-3.
What is the DSSTox Substance ID of 3-(Aminocarbonyl)-5-fluorophenylboronic acid?
The DSSTox Substance ID is DTXSID30660237.
Is 3-(Aminocarbonyl)-5-fluorophenylboronic acid considered as a canonicalized compound?
Yes, 3-(Aminocarbonyl)-5-fluorophenylboronic acid is considered as a canonicalized compound.