What is the molecular formula of 3-Amino-3-phenyl-propionic acid ethyl ester?
The molecular formula is C11H15NO2.
What is the molecular weight of 3-Amino-3-phenyl-propionic acid ethyl ester?
The molecular weight is 193.24 g/mol.
What is the IUPAC name of 3-Amino-3-phenyl-propionic acid ethyl ester?
The IUPAC name is ethyl 3-amino-3-phenylpropanoate.
What is the InChI of 3-Amino-3-phenyl-propionic acid ethyl ester?
The InChI is InChI=1S/C11H15NO2/c1-2-14-11(13)8-10(12)9-6-4-3-5-7-9/h3-7,10H,2,8,12H2,1H3.
What is the InChIKey of 3-Amino-3-phenyl-propionic acid ethyl ester?
The InChIKey is NUWRDXMXYDWUAN-UHFFFAOYSA-N.
What is the Canonical SMILES of 3-Amino-3-phenyl-propionic acid ethyl ester?
The Canonical SMILES is CCOC(=O)CC(C1=CC=CC=C1)N.
What is the CAS number of 3-Amino-3-phenyl-propionic acid ethyl ester?
The CAS number is 6335-76-8.
What is the European Community (EC) number of 3-Amino-3-phenyl-propionic acid ethyl ester?
The European Community (EC) number is 613-206-6.
How many hydrogen bond donor atoms does 3-Amino-3-phenyl-propionic acid ethyl ester have?
It has 1 hydrogen bond donor atom.
How many hydrogen bond acceptor atoms does 3-Amino-3-phenyl-propionic acid ethyl ester have?
It has 3 hydrogen bond acceptor atoms.