3,9-Dicyclohex-3-enyl-2,4,8,10-tetraoxaspiro[5.5]undecane

• CAS: 6600-31-3
• Catalog Number: ACM6600313
• Category: Other Products
• Molecular Weight: 320.42322
• Molecular Formula: C₁₉H₂₈O₄
• Synonyms: 3,9-dicyclohex-3-enyl-2,4,8,10-tetraoxaspiro[5.5]undecane ;2,4,8,10-Tetraoxaspiro5.5undecane, 3,9-di-3-cyclohexen-1-yl-;3,9-Dicyclohex-3-enyl-2,4,8,10-tetraoxaspiro[5.5]undecan;3,9-Bis(3-cyclohexen-1-yl)-2,4,8,10-tetraoxaspiro[5.5]undecane;3,9-Bis(3-cyclohexenyl)-2,4,8,10-tetraoxaspiro[5.5]undecane;3,9-Di(3-cyclohexenyl)-2,4,8,10-tetraoxaspiro[5.5]undecane;2,4,8,10-Tetraoxaspiro[5.5]undecane, 3,9-di(3-cyclohexenyl)-;Bis(.delta.-tetrahydrobenzylidene)pentaerythritol

Custom Q&A

What is the molecular formula of the compound with PubChem CID 98143?

The molecular formula is C19H28O4.

What are some synonyms for the compound with PubChem CID 98143?

Some synonyms include 6600-31-3, Bis(delta-tetrahydrobenzylidene)pentaerythritol, and 3,9-dicyclohex-3-enyl-2,4,8,10-tetraoxaspiro[5.5]undecane.

What is the molecular weight of the compound with PubChem CID 98143?

The molecular weight is 320.4 g/mol.

What is the InChI of the compound with PubChem CID 98143?

The InChI is InChI=1S/C19H28O4/c1-3-7-15(8-4-1)17-20-11-19(12-21-17)13-22-18(23-14-19)16-9-5-2-6-10-16/h1-3,5,15-18H,4,6-14H2.

What is the Canonical SMILES of the compound with PubChem CID 98143?

The Canonical SMILES is C1CC(CC=C1)C2OCC3(CO2)COC(OC3)C4CCC=CC4.

How many hydrogen bond acceptor counts does the compound with PubChem CID 98143 have?

The compound has 4 hydrogen bond acceptor counts.

What is the exact mass of the compound with PubChem CID 98143?

The exact mass is 320.19875937 g/mol.

How many rotatable bond counts does the compound with PubChem CID 98143 have?

The compound has 2 rotatable bond counts.

What is the topological polar surface area of the compound with PubChem CID 98143?

The topological polar surface area is 36.9 Ų.

How many undefined atom stereocenter counts does the compound with PubChem CID 98143 have?

The compound has 2 undefined atom stereocenter counts.