3,6-dichloropyrazine-2-carboxylic acid

• CAS: 356783-15-8
• Catalog Number: ACM356783158
• Category: Pyrazines
• Molecular Weight: 193.0
• Molecular Formula: C5H2Cl2N2O2
• Appearance: Off-white powder

Custom Q&A

What is the molecular formula of 3,6-dichloropyrazine-2-carboxylic acid?

The molecular formula is C5H2Cl2N2O2.

When was 3,6-dichloropyrazine-2-carboxylic acid first created?

It was first created on December 5, 2007.

What is the molecular weight of 3,6-dichloropyrazine-2-carboxylic acid?

The molecular weight is 192.98 g/mol.

What is the IUPAC name of 3,6-dichloropyrazine-2-carboxylic acid?

The IUPAC name is 3,6-dichloropyrazine-2-carboxylic acid.

What is the InChI of 3,6-dichloropyrazine-2-carboxylic acid?

The InChI is InChI=1S/C5H2Cl2N2O2/c6-2-1-8-4(7)3(9-2)5(10)11/h1H,(H,10,11).

How many hydrogen bond donor counts are there in 3,6-dichloropyrazine-2-carboxylic acid?

There is 1 hydrogen bond donor count.

What is the XLogP3-AA value of 3,6-dichloropyrazine-2-carboxylic acid?

The XLogP3-AA value is 1.6.

How many rotatable bond counts are there in 3,6-dichloropyrazine-2-carboxylic acid?

There is 1 rotatable bond count.

What is the topological polar surface area of 3,6-dichloropyrazine-2-carboxylic acid?

The topological polar surface area is 63.1 Ų.

Is the compound canonicalized?

Yes, the compound is canonicalized.