3,5-Dimethyl-2-(1H-pyrazol-5-yl)pyridine

• CAS: 1353762-17-0
• Catalog Number: ACM1353762170
• Category: Pyridines
• Molecular Weight: 173.22
• Molecular Formula: C10H11N3
• Synonyms: 3,5-Dimethyl-2-(1H-pyrazol-3-yl)pyridine

Custom Q&A

What is the molecular formula of 3,5-Dimethyl-2-(1H-pyrazol-5-yl)pyridine?

The molecular formula is C10H11N3.

What is the molecular weight of 3,5-Dimethyl-2-(1H-pyrazol-5-yl)pyridine?

The molecular weight is 173.21 g/mol.

What is the IUPAC name of 3,5-Dimethyl-2-(1H-pyrazol-5-yl)pyridine?

The IUPAC name is 3,5-dimethyl-2-(1H-pyrazol-5-yl)pyridine.

What is the InChI of 3,5-Dimethyl-2-(1H-pyrazol-5-yl)pyridine?

The InChI is InChI=1S/C10H11N3/c1-7-5-8(2)10(11-6-7)9-3-4-12-13-9/h3-6H,1-2H3,(H,12,13).

What is the InChIKey of 3,5-Dimethyl-2-(1H-pyrazol-5-yl)pyridine?

The InChIKey is INJFPDGDCKCFHY-UHFFFAOYSA-N.

What is the canonical SMILES of 3,5-Dimethyl-2-(1H-pyrazol-5-yl)pyridine?

The canonical SMILES is CC1=CC(=C(N=C1)C2=CC=NN2)C.

What is the XLogP3-AA value of 3,5-Dimethyl-2-(1H-pyrazol-5-yl)pyridine?

The XLogP3-AA value is 1.6.

How many hydrogen bond donor counts does 3,5-Dimethyl-2-(1H-pyrazol-5-yl)pyridine have?

It has 1 hydrogen bond donor count.

How many hydrogen bond acceptor counts does 3,5-Dimethyl-2-(1H-pyrazol-5-yl)pyridine have?

It has 2 hydrogen bond acceptor counts.

How many rotatable bond counts does 3,5-Dimethyl-2-(1H-pyrazol-5-yl)pyridine have?

It has 1 rotatable bond count.