What is the molecular formula of 3,5-Dimethyl-2-(1H-pyrazol-5-yl)pyridine?
The molecular formula is C10H11N3.
What is the molecular weight of 3,5-Dimethyl-2-(1H-pyrazol-5-yl)pyridine?
The molecular weight is 173.21 g/mol.
What is the IUPAC name of 3,5-Dimethyl-2-(1H-pyrazol-5-yl)pyridine?
The IUPAC name is 3,5-dimethyl-2-(1H-pyrazol-5-yl)pyridine.
What is the InChI of 3,5-Dimethyl-2-(1H-pyrazol-5-yl)pyridine?
The InChI is InChI=1S/C10H11N3/c1-7-5-8(2)10(11-6-7)9-3-4-12-13-9/h3-6H,1-2H3,(H,12,13).
What is the InChIKey of 3,5-Dimethyl-2-(1H-pyrazol-5-yl)pyridine?
The InChIKey is INJFPDGDCKCFHY-UHFFFAOYSA-N.
What is the canonical SMILES of 3,5-Dimethyl-2-(1H-pyrazol-5-yl)pyridine?
The canonical SMILES is CC1=CC(=C(N=C1)C2=CC=NN2)C.
What is the XLogP3-AA value of 3,5-Dimethyl-2-(1H-pyrazol-5-yl)pyridine?
The XLogP3-AA value is 1.6.
How many hydrogen bond donor counts does 3,5-Dimethyl-2-(1H-pyrazol-5-yl)pyridine have?
It has 1 hydrogen bond donor count.
How many hydrogen bond acceptor counts does 3,5-Dimethyl-2-(1H-pyrazol-5-yl)pyridine have?
It has 2 hydrogen bond acceptor counts.
How many rotatable bond counts does 3,5-Dimethyl-2-(1H-pyrazol-5-yl)pyridine have?
It has 1 rotatable bond count.