3,5-Difluorophenylacetonitrile

• CAS: 122376-76-5
• Catalog Number: ACM122376765
• Category: Aryl Fluorinated Building Blocks
• Molecular Weight: 153.13
• Hazard Statements: H302 + H312 + H332-H315-H319-H335
• RIDADR: NONH for all modes of transport
• Symbol: GHS07

Custom Q&A

What is the PubChem CID for 3,5-Difluorophenylacetonitrile?

The PubChem CID for 3,5-Difluorophenylacetonitrile is 518565.

What is the molecular formula of 3,5-Difluorophenylacetonitrile?

The molecular formula of 3,5-Difluorophenylacetonitrile is C8H5F2N.

What is the molecular weight of 3,5-Difluorophenylacetonitrile?

The molecular weight of 3,5-Difluorophenylacetonitrile is 153.13 g/mol.

What is the IUPAC name of 3,5-Difluorophenylacetonitrile?

The IUPAC name of 3,5-Difluorophenylacetonitrile is 2-(3,5-difluorophenyl)acetonitrile.

What is the InChI of 3,5-Difluorophenylacetonitrile?

The InChI of 3,5-Difluorophenylacetonitrile is InChI=1S/C8H5F2N/c9-7-3-6(1-2-11)4-8(10)5-7/h3-5H,1H2.

What is the InChIKey of 3,5-Difluorophenylacetonitrile?

The InChIKey of 3,5-Difluorophenylacetonitrile is OBMYMTSBABEPIB-UHFFFAOYSA-N.

What is the canonical SMILES of 3,5-Difluorophenylacetonitrile?

The canonical SMILES of 3,5-Difluorophenylacetonitrile is C1=C(C=C(C=C1F)F)CC#N.

What is the CAS number of 3,5-Difluorophenylacetonitrile?

The CAS number of 3,5-Difluorophenylacetonitrile is 122376-76-5.

What is the European Community (EC) Number of 3,5-Difluorophenylacetonitrile?

The European Community (EC) Number of 3,5-Difluorophenylacetonitrile is 625-700-9.

Is 3,5-Difluorophenylacetonitrile a canonicalized compound?

Yes, 3,5-Difluorophenylacetonitrile is a canonicalized compound.