3,5-Difluoro-L-tyrosine

• CAS: 73246-30-7
• Catalog Number: ACM73246307
• Category: Other Products
• Molecular Weight: 217.1694664
• Molecular Formula: C₉H₉F₂NO₃
• Synonyms: 3,5-Difluoro-L-tyrosine;H-Tyr(3,5-F2)-OH;(S)-2-amino-3-(3,5-difluoro-4-hydroxyphenyl)propanoic acid

Custom Q&A

What is the molecular formula of 3,5-Difluoro-L-tyrosine?

The molecular formula of 3,5-Difluoro-L-tyrosine is C9H9F2NO3.

What is the molecular weight of 3,5-Difluoro-L-tyrosine?

The molecular weight of 3,5-Difluoro-L-tyrosine is 217.17 g/mol.

What is the IUPAC name of 3,5-Difluoro-L-tyrosine?

The IUPAC name of 3,5-Difluoro-L-tyrosine is (2S)-2-amino-3-(3,5-difluoro-4-hydroxyphenyl)propanoic acid.

What is the Canonical SMILES of 3,5-Difluoro-L-tyrosine?

The Canonical SMILES of 3,5-Difluoro-L-tyrosine is C1=C(C=C(C(=C1F)O)F)CC(C(=O)O)N.

How many hydrogen bond donor counts does 3,5-Difluoro-L-tyrosine have?

3,5-Difluoro-L-tyrosine has 3 hydrogen bond donor counts.

What is the exact mass of 3,5-Difluoro-L-tyrosine?

The exact mass of 3,5-Difluoro-L-tyrosine is 217.05504947 g/mol.

How many rotatable bond counts does 3,5-Difluoro-L-tyrosine have?

3,5-Difluoro-L-tyrosine has 3 rotatable bond counts.

Is 3,5-Difluoro-L-tyrosine a canonicalized compound?

Yes, 3,5-Difluoro-L-tyrosine is a canonicalized compound.

What is the topological polar surface area of 3,5-Difluoro-L-tyrosine?

The topological polar surface area of 3,5-Difluoro-L-tyrosine is 83.6 Ų.

How many defined atom stereocenter counts does 3,5-Difluoro-L-tyrosine have?

3,5-Difluoro-L-tyrosine has 1 defined atom stereocenter count.