3,5-Dichloro-4-(prop-2-yn-1-yloxy)benzaldehyde

• CAS: 426229-84-7
• Catalog Number: ACM426229847
• Category: Ethers
• Molecular Weight: 229.06
• Molecular Formula: C₁₁H₂₂N₂O₂
• Synonyms: CHEMBRDG-BB 4022593;3,5-DICHLORO-4-(PROP-2-YN-1-YLOXY)BENZALDEHYDE
• Hazard Statements: H315-H319-H335-H411
• RIDADR: NONH for all modes of transport
• Symbol: GHS07

Custom Q&A

What is the molecular formula of 3,5-Dichloro-4-(prop-2-yn-1-yloxy)benzaldehyde?

The molecular formula is C10H6Cl2O2.

What is the molecular weight of 3,5-Dichloro-4-(prop-2-yn-1-yloxy)benzaldehyde?

The molecular weight is 229.06 g/mol.

What is the IUPAC name of 3,5-Dichloro-4-(prop-2-yn-1-yloxy)benzaldehyde?

The IUPAC name is 3,5-dichloro-4-prop-2-ynoxybenzaldehyde.

What is the InChI code of 3,5-Dichloro-4-(prop-2-yn-1-yloxy)benzaldehyde?

The InChI code is InChI=1S/C10H6Cl2O2/c1-2-3-14-10-8(11)4-7(6-13)5-9(10)12/h1,4-6H,3H2.

What is the Canonical SMILES representation of 3,5-Dichloro-4-(prop-2-yn-1-yloxy)benzaldehyde?

The Canonical SMILES is C#CCOC1=C(C=C(C=C1Cl)C=O)Cl.

What is the XLogP3 value of 3,5-Dichloro-4-(prop-2-yn-1-yloxy)benzaldehyde?

The XLogP3 value is 3.

How many hydrogen bond acceptors are there in 3,5-Dichloro-4-(prop-2-yn-1-yloxy)benzaldehyde?

There are 2 hydrogen bond acceptors.

What is the exact mass of 3,5-Dichloro-4-(prop-2-yn-1-yloxy)benzaldehyde?

The exact mass is 227.9744848 g/mol.

What is the topological polar surface area of 3,5-Dichloro-4-(prop-2-yn-1-yloxy)benzaldehyde?

The topological polar surface area is 26.3Ų.

Is 3,5-Dichloro-4-(prop-2-yn-1-yloxy)benzaldehyde considered a canonicalized compound?

Yes, it is considered a canonicalized compound according to PubChem.