67853-37-6 Purity
95%
If you have any other questions or need other size, please get a quote.
Specification
The molecular formula of 3,5-Dibromo-4-methylbenzoic acid is C8H6Br2O2.
The synonyms of 3,5-Dibromo-4-methylbenzoic acid are 3,5-dibromo-4-methylbenzoic acid, 67973-32-4, 3,5-Dibromo-p-toluic acid, MFCD00017544, Benzoic acid, 3,5-dibromo-4-methyl-, and more.
The molecular weight of 3,5-Dibromo-4-methylbenzoic acid is 293.94 g/mol.
The IUPAC name of 3,5-Dibromo-4-methylbenzoic acid is 3,5-dibromo-4-methylbenzoic acid.
The InChI of 3,5-Dibromo-4-methylbenzoic acid is InChI=1S/C8H6Br2O2/c1-4-6(9)2-5(8(11)12)3-7(4)10/h2-3H,1H3,(H,11,12).
The InChIKey of 3,5-Dibromo-4-methylbenzoic acid is SJCBUASMFSRONS-UHFFFAOYSA-N.
The canonical SMILES of 3,5-Dibromo-4-methylbenzoic acid is CC1=C(C=C(C=C1Br)C(=O)O)Br.
The XLogP3-AA value of 3,5-Dibromo-4-methylbenzoic acid is 3.2.
The hydrogen bond donor count of 3,5-Dibromo-4-methylbenzoic acid is 1.
The hydrogen bond acceptor count of 3,5-Dibromo-4-methylbenzoic acid is 2.