3,5-Diacetamido-2,4,6-triiodobenzoic acid

• CAS: 50978-11-5
• Catalog Number: ACM50978115
• Category: Other Products
• Molecular Weight: 649.93
• Molecular Formula: C₁₁H₉I₃N₂O₄.₂H₂O
• Synonyms: DIATRIZOIC ACID DIHYDRATE;DIATRIZOIC ACID USP;Benzoic acid, 3,5-bis(acetylamino)-2,4,6-triiodo-, dihydrate;DIAZTRIZOICACID,DIHYDRATE;DIATRIZOICACID,DIHYDRATE,USP;3,5-DIACETAMIDO- 2,4,6-TRIIODOBENZOIC ACID (DIATRIZOIC ACID DIHYDRATE);3,5-Diacetamido-2,4,6-triiodobenzoic acid;Diatrizoic acid

Custom Q&A

What is the molecular formula of amidotrizoic acid?

The molecular formula of amidotrizoic acid is C11H9I3N2O4.

What are some synonyms for amidotrizoic acid?

Some synonyms for amidotrizoic acid are diatrizoic acid and urogranoic acid.

What is the molecular weight of amidotrizoic acid?

The molecular weight of amidotrizoic acid is 613.91 g/mol.

What is the role of amidotrizoic acid as mentioned in the description?

Amidotrizoic acid has a role as a radioopaque medium in gastrointestinal studies, angiography, and urography.

What is the IUPAC name of amidotrizoic acid?

The IUPAC name of amidotrizoic acid is 3,5-diacetamido-2,4,6-triiodobenzoic acid.

What is the InChIKey of amidotrizoic acid?

The InChIKey of amidotrizoic acid is YVPYQUNUQOZFHG-UHFFFAOYSA-N.

What is the Canonical SMILES representation of amidotrizoic acid?

The Canonical SMILES representation of amidotrizoic acid is CC(=O)NC1=C(C(=C(C(=C1I)C(=O)O)I)NC(=O)C)I.

What is the CAS number of amidotrizoic acid?

The CAS number of amidotrizoic acid is 117-96-4.

What is the XLogP3-AA value of amidotrizoic acid?

The XLogP3-AA value of amidotrizoic acid is 1.8.

What is the topological polar surface area of amidotrizoic acid?

The topological polar surface area of amidotrizoic acid is 95.5 Ų.