CAS
--- Purity
---
--- Purity
---
Inquiry Basket
3,5-Bis(trifluoromethyl)benzyl chloride
CAS
75462-59-8
Catalog Number
ACM75462598
Category
Alcohols
Molecular Weight
262.58
If you have any other questions or need other size, please get a quote.
- Product Description
- Case Study
- Custom Reviews
- Custom Q&A
- Synthetic Use
- Related Resources
Specification
Hazard Statements
H319
RIDADR
UN 2920 3(8) / PGII
Symbol
GHS07
What is the PubChem CID of 3,5-Bis(trifluoromethyl)benzyl chloride?
The PubChem CID of 3,5-Bis(trifluoromethyl)benzyl chloride is 123576.
What is the molecular formula of 3,5-Bis(trifluoromethyl)benzyl chloride?
The molecular formula of 3,5-Bis(trifluoromethyl)benzyl chloride is C9H5ClF6.
What is the molecular weight of 3,5-Bis(trifluoromethyl)benzyl chloride?
The molecular weight of 3,5-Bis(trifluoromethyl)benzyl chloride is 262.58 g/mol.
What is the IUPAC name of 3,5-Bis(trifluoromethyl)benzyl chloride?
The IUPAC name of 3,5-Bis(trifluoromethyl)benzyl chloride is 1-(chloromethyl)-3,5-bis(trifluoromethyl)benzene.
What is the InChI of 3,5-Bis(trifluoromethyl)benzyl chloride?
The InChI of 3,5-Bis(trifluoromethyl)benzyl chloride is InChI=1S/C9H5ClF6/c10-4-5-1-6(8(11,12)13)3-7(2-5)9(14,15)16/h1-3H,4H2.
What is the InChIKey of 3,5-Bis(trifluoromethyl)benzyl chloride?
The InChIKey of 3,5-Bis(trifluoromethyl)benzyl chloride is OINTXXMBRBLMHH-UHFFFAOYSA-N.
What is the canonical SMILES of 3,5-Bis(trifluoromethyl)benzyl chloride?
The canonical SMILES of 3,5-Bis(trifluoromethyl)benzyl chloride is C1=C(C=C(C=C1C(F)(F)F)C(F)(F)F)CCl.
What is the CAS number of 3,5-Bis(trifluoromethyl)benzyl chloride?
The CAS number of 3,5-Bis(trifluoromethyl)benzyl chloride is 75462-59-8.
What is the European Community (EC) number of 3,5-Bis(trifluoromethyl)benzyl chloride?
The European Community (EC) number of 3,5-Bis(trifluoromethyl)benzyl chloride is 278-216-1.
Is 3,5-Bis(trifluoromethyl)benzyl chloride a canonicalized compound?
Yes, 3,5-Bis(trifluoromethyl)benzyl chloride is a canonicalized compound.
Downstream Synthesis Route 1
- 39546-32-2
- 75462-59-8
- 380424-41-9
Reference: [1]Shum; Peet; Weintraub; Le; Zhao; Barbone; Cashman; Tsay; Dwyer; Loos; Powers; Kropp; Wright; Bitonti; Dumont; Borcherding
[Nucleosides, nucleotides and nucleic acids, 2001, vol. 20, # 4-7, p. 1067 - 1078]
* For details of the synthesis route, please refer to the original source to ensure accuracy.
Recommended Products
