3,4-Difluorobenzoyl chloride

• CAS: 76903-88-3
• Catalog Number: ACM76903883
• Category: Aryl Fluorinated Building Blocks
• Molecular Weight: 176.55
• Hazard Statements: H302-H312-H315-H319-H332-H335
• RIDADR: UN 2920 3(8) / PGII
• Symbol: GHS07

Custom Q&A

What is the molecular formula of 3,4-Difluorobenzoyl chloride?

The molecular formula is C7H3ClF2O.

When was the PubChem CID for 3,4-Difluorobenzoyl chloride created?

The PubChem CID was created on 2005-07-19.

What is the molecular weight of 3,4-Difluorobenzoyl chloride?

The molecular weight is 176.55 g/mol.

What is the InChIKey of 3,4-Difluorobenzoyl chloride?

The InChIKey is RPQWXGVZELKOEU-UHFFFAOYSA-N.

How many hydrogen bond acceptor counts does 3,4-Difluorobenzoyl chloride have?

It has 3 hydrogen bond acceptor counts.

What is the topological polar surface area of 3,4-Difluorobenzoyl chloride?

The topological polar surface area is 17.1 2.

Does 3,4-Difluorobenzoyl chloride have any defined atom stereocenter count?

No, it does not have any defined atom stereocenter count.

How many covalently-bonded units does 3,4-Difluorobenzoyl chloride have?

It has 1 covalently-bonded unit.

What is the canonical SMILES representation of 3,4-Difluorobenzoyl chloride?

The canonical SMILES is C1=CC(=C(C=C1C(=O)Cl)F)F.

What is the exact mass of 3,4-Difluorobenzoyl chloride?

The exact mass is 175.9840487 g/mol.