What is the molecular formula of 3-(3-Hydroxy-3-methylbut-1-yn-1-yl)benzoic acid?
The molecular formula is C12H12O3.
What is the molecular weight of 3-(3-Hydroxy-3-methylbut-1-yn-1-yl)benzoic acid?
The molecular weight is 204.22 g/mol.
When was 3-(3-Hydroxy-3-methylbut-1-yn-1-yl)benzoic acid created?
It was created on May 28, 2009.
When was 3-(3-Hydroxy-3-methylbut-1-yn-1-yl)benzoic acid last modified?
It was last modified on November 25, 2023.
What is the IUPAC name of 3-(3-Hydroxy-3-methylbut-1-yn-1-yl)benzoic acid?
The IUPAC name is 3-(3-hydroxy-3-methylbut-1-ynyl)benzoic acid.
What is the InChI code of 3-(3-Hydroxy-3-methylbut-1-yn-1-yl)benzoic acid?
The InChI code is InChI=1S/C12H12O3/c1-12(2,15)7-6-9-4-3-5-10(8-9)11(13)14/h3-5,8,15H,1-2H3,(H,13,14).
What is the InChIKey of 3-(3-Hydroxy-3-methylbut-1-yn-1-yl)benzoic acid?
The InChIKey is VKXLALQKRXWOJK-UHFFFAOYSA-N.
What is the canonical SMILES representation of 3-(3-Hydroxy-3-methylbut-1-yn-1-yl)benzoic acid?
The canonical SMILES representation is CC(C)(C#CC1=CC(=CC=C1)C(=O)O).
What is the CAS number of 3-(3-Hydroxy-3-methylbut-1-yn-1-yl)benzoic acid?
The CAS number is 878742-28-0.
What is the XLogP3 value of 3-(3-Hydroxy-3-methylbut-1-yn-1-yl)benzoic acid?
The XLogP3 value is 2.1.