--- Purity
---
If you have any other questions or need other size, please get a quote.
Specification
The molecular formula of the compound is C15H13ClO3.
The molecular weight of the compound is 276.71 g/mol.
The IUPAC name of the compound is 3-[(3-chlorophenyl)methoxy]-4-methoxybenzaldehyde.
The Canonical SMILES representation of the compound is COC1=C(C=C(C=C1)C=O)OCC2=CC(=CC=C2)Cl.
The InChIKey of the compound is PKGAYSJHJKNIJF-UHFFFAOYSA-N.
The XLogP3-AA value of the compound is 3.4.
There are 3 hydrogen bond acceptors present in the compound.
The compound has 5 rotatable bond counts.
The exact mass of the compound is 276.0553220 g/mol.
Yes, the compound is canonicalized.