3-(2-Iodophenyl)propionic acid

• CAS: 96606-95-0
• Catalog Number: ACM96606950
• Category: Arenes
• Molecular Weight: 276.07
• Molecular Formula: C₉H₈
• Synonyms: 3-(2-IODOPHENYL)PROPIONIC ACID;3-(2-iodophenyl)propanoic acid;3-(2-lodophenyl)propionic acid;3-(2-Iodphenyl)propionsSre
• Hazard Statements: H301-H312-H315-H319-H335-H372-H410
• RIDADR: UN 3295C 3 / PGIII
• Symbol: GHS06

Custom Q&A

What is the molecular formula of the compound?

The molecular formula of the compound is C9H9IO2.

What is the molecular weight of the compound?

The molecular weight of the compound is 276.07 g/mol.

What is the IUPAC name of the compound?

The IUPAC name of the compound is 3-(2-iodophenyl)propanoic acid.

What is the InChI of the compound?

The InChI of the compound is InChI=1S/C9H9IO2/c10-8-4-2-1-3-7(8)5-6-9(11)12/h1-4H,5-6H2,(H,11,12).

What is the InChIKey of the compound?

The InChIKey of the compound is POJTZKMVSQVKNR-UHFFFAOYSA-N.

What is the CAS number of the compound?

The CAS number of the compound is 96606-95-0.

What is the XLogP3-AA value of the compound?

The XLogP3-AA value of the compound is 2.3.

How many hydrogen bond donor counts does the compound have?

The compound has 1 hydrogen bond donor count.

How many hydrogen bond acceptor counts does the compound have?

The compound has 2 hydrogen bond acceptor counts.

What is the topological polar surface area of the compound?

The topological polar surface area of the compound is 37.3Ų.