3-(2-Bromoacetyl)-5-chlorothiophene-2-sulfonamide

• CAS: 160982-11-6
• Catalog Number: ACM160982116
• Category: Bromine Series
• Molecular Weight: 318.60
• Molecular Formula: C₆H₅BrClNO₃S₂
• Density: 1.936

Custom Q&A

What is the molecular formula of the compound?

The molecular formula is C6H5BrClNO3S2.

What is the molecular weight of the compound?

The molecular weight is 318.6 g/mol.

What is the IUPAC name of the compound?

The IUPAC name is 3-(2-bromoacetyl)-5-chlorothiophene-2-sulfonamide.

What is the InChI of the compound?

The InChI is InChI=1S/C6H5BrClNO3S2/c7-2-4(10)3-1-5(8)13-6(3)14(9,11)12/h1H,2H2,(H2,9,11,12).

What is the InChIKey of the compound?

The InChIKey is OZESFFKYLOCAOV-UHFFFAOYSA-N.

What is the canonical SMILES of the compound?

The canonical SMILES is C1=C(SC(=C1C(=O)CBr)S(=O)(=O)N)Cl.

What is the CAS number of the compound?

The CAS number is 160982-11-6.

What is the European Community (EC) number of the compound?

The European Community (EC) number is 605-241-0.

What is the hydrogen bond donor count of the compound?

The hydrogen bond donor count is 1.

What is the hydrogen bond acceptor count of the compound?

The hydrogen bond acceptor count is 5.