(2S,3R,4R,5S)-2,3,4,5-Tetrahydroxy-6-oxo-hexanoic acid

• CAS: 3402-98-0
• Catalog Number: ACM3402980
• Category: Other Products
• Molecular Weight: 0
• Molecular Formula: C₆H₁₀O₇
• Synonyms: (2S,3R,4R,5S)-2,3,4,5-tetrahydroxy-6-oxo-hexanoic acid;rac-(2R*,3S*,4S*,5R*)-2,3,4,5-Tetrahydroxy-6-oxohexanoic acid

Custom Q&A

What is the molecular formula of (2S,3R,4R,5S)-2,3,4,5-Tetrahydroxy-6-oxo-hexanoic acid?

The molecular formula is C6H10O7.

What is the molecular weight of (2S,3R,4R,5S)-2,3,4,5-Tetrahydroxy-6-oxo-hexanoic acid?

The molecular weight is 194.14 g/mol.

What is the IUPAC name of (2S,3R,4R,5S)-2,3,4,5-Tetrahydroxy-6-oxo-hexanoic acid?

The IUPAC name is 2,3,4,5-tetrahydroxy-6-oxohexanoic acid.

What is the Canonical SMILES of (2S,3R,4R,5S)-2,3,4,5-Tetrahydroxy-6-oxo-hexanoic acid?

The Canonical SMILES is C(=O)C(C(C(C(C(=O)O)O)O)O)O.

What is the InChIKey of (2S,3R,4R,5S)-2,3,4,5-Tetrahydroxy-6-oxo-hexanoic acid?

The InChIKey is IAJILQKETJEXLJ-UHFFFAOYSA-N.

How many hydrogen bond donor counts are there in (2S,3R,4R,5S)-2,3,4,5-Tetrahydroxy-6-oxo-hexanoic acid?

There are 5 hydrogen bond donor counts.

What is the XLogP3 value of (2S,3R,4R,5S)-2,3,4,5-Tetrahydroxy-6-oxo-hexanoic acid?

The XLogP3 value is -2.6.

What is the topological polar surface area of (2S,3R,4R,5S)-2,3,4,5-Tetrahydroxy-6-oxo-hexanoic acid?

The topological polar surface area is 135 Å2.

Is (2S,3R,4R,5S)-2,3,4,5-Tetrahydroxy-6-oxo-hexanoic acid a canonicalized compound?

Yes, it is a canonicalized compound.

How many defined atom stereocenter counts are there in (2S,3R,4R,5S)-2,3,4,5-Tetrahydroxy-6-oxo-hexanoic acid?

There are 0 defined atom stereocenter counts.