(2R)-2-AMINO-3-(TETRAHYDROFURAN-3-YL)PROPANOIC ACID

• CAS: 1344974-68-0
• Catalog Number: ACM1344974680
• Category: Furans
• Molecular Weight: 159.18
• Molecular Formula: C7H13NO3

Custom Q&A

What is the molecular formula of (2R)-2-Amino-3-(tetrahydrofuran-3-yl)propanoic acid?

The molecular formula is C7H13NO3.

What are the synonyms for (2R)-2-Amino-3-(tetrahydrofuran-3-yl)propanoic acid?

The synonyms are (2R)-2-Amino-3-(tetrahydrofuran-3-yl)propanoic acid, (2R)-2-AMINO-3-(OXOLAN-3-YL)PROPANOIC ACID, and 3-Oxolan-3-yl-D-alanine.

What is the molecular weight of (2R)-2-Amino-3-(tetrahydrofuran-3-yl)propanoic acid?

The molecular weight is 159.18 g/mol.

What is the IUPAC name of (2R)-2-Amino-3-(tetrahydrofuran-3-yl)propanoic acid?

The IUPAC name is (2R)-2-amino-3-(oxolan-3-yl)propanoic acid.

What is the InChI of (2R)-2-Amino-3-(tetrahydrofuran-3-yl)propanoic acid?

The InChI is InChI=1S/C7H13NO3/c8-6(7(9)10)3-5-1-2-11-4-5/h5-6H,1-4,8H2,(H,9,10)/t5?,6-/m1/s1.

What is the InChIKey of (2R)-2-Amino-3-(tetrahydrofuran-3-yl)propanoic acid?

The InChIKey is OTUZUAJROYEUAS-PRJDIBJQSA-N.

What is the canonical SMILES of (2R)-2-Amino-3-(tetrahydrofuran-3-yl)propanoic acid?

The canonical SMILES is C1COCC1CC(C(=O)O)N.

What is the isomeric SMILES of (2R)-2-Amino-3-(tetrahydrofuran-3-yl)propanoic acid?

The isomeric SMILES is C1COCC1C[C@H](C(=O)O)N.

What are the other identifiers for (2R)-2-Amino-3-(tetrahydrofuran-3-yl)propanoic acid?

The CAS number is 1344974-68-0 and the DSSTox Substance ID is DTXSID10743976.

What is the XLogP3-AA value of (2R)-2-Amino-3-(tetrahydrofuran-3-yl)propanoic acid?

The XLogP3-AA value is -2.8.