What is the molecular formula of 2-Trifluoroacetylpyridine-4-boronicacid?
The molecular formula is C7H5BF3NO3.
What is the IUPAC name of 2-Trifluoroacetylpyridine-4-boronicacid?
The IUPAC name is [2-(2,2,2-trifluoroacetyl)pyridin-4-yl]boronic acid.
What is the InChI of 2-Trifluoroacetylpyridine-4-boronicacid?
The InChI is InChI=1S/C7H5BF3NO3/c9-7(10,11)6(13)5-3-4(8(14)15)1-2-12-5/h1-3,14-15H.
What is the InChIKey of 2-Trifluoroacetylpyridine-4-boronicacid?
The InChIKey is JCUPTTRMSGGKLE-UHFFFAOYSA-N.
What is the canonical SMILES of 2-Trifluoroacetylpyridine-4-boronicacid?
The canonical SMILES is B(C1=CC(=NC=C1)C(=O)C(F)(F)F)(O)O.
What is the CAS number of 2-Trifluoroacetylpyridine-4-boronicacid?
The CAS number is 1310404-58-0.
What is the molecular weight of 2-Trifluoroacetylpyridine-4-boronicacid?
The molecular weight is 218.93 g/mol.
How many hydrogen bond donor counts does 2-Trifluoroacetylpyridine-4-boronicacid have?
It has 2 hydrogen bond donor counts.
How many hydrogen bond acceptor counts does 2-Trifluoroacetylpyridine-4-boronicacid have?
It has 7 hydrogen bond acceptor counts.
How many rotatable bond counts does 2-Trifluoroacetylpyridine-4-boronicacid have?
It has 2 rotatable bond counts.